C20H22N2O2S2 — CID 55498469
N-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(2-phenylacetyl)amino]propanamide (PubChem CID 55498469) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(2-phenylacetyl)amino]propanamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(2-phenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 55498469 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-3-[(2-phenylacetyl)amino]propanamide |
| SMILES | O=C(Cc1ccccc1)NCCC(=O)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C20H22N2O2S2/c23-18(9-10-21-19(24)13-15-5-2-1-3-6-15)22-17-8-4-7-16(14-17)20-25-11-12-26-20/h1-8,14,20H,9-13H2,(H,21,24)(H,22,23) |
| InChIKey | RSTAPTOIBGITIZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |