C21H22N2OS2 — CID 27842678
N-[3-(1,3-dithian-2-yl)phenyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 27842678) has the molecular formula C21H22N2OS2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 27842678 |
| Molecular Formula | C21H22N2OS2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(CCc1c[nH]c2ccccc12)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C21H22N2OS2/c24-20(10-9-16-14-22-19-8-2-1-7-18(16)19)23-17-6-3-5-15(13-17)21-25-11-4-12-26-21/h1-3,5-8,13-14,21-22H,4,9-12H2,(H,23,24) |
| InChIKey | RQXWNHNXPGUJIU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |