C19H21NOS2 — CID 27843051
N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-methylphenyl)acetamide (PubChem CID 27843051) has the molecular formula C19H21NOS2 and a molecular weight of 343.52 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-methylphenyl)acetamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27843051 |
| Molecular Formula | C19H21NOS2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1CC(=O)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C19H21NOS2/c1-14-6-2-3-7-15(14)13-18(21)20-17-9-4-8-16(12-17)19-22-10-5-11-23-19/h2-4,6-9,12,19H,5,10-11,13H2,1H3,(H,20,21) |
| InChIKey | AFFUNTZISCYVJG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |