C19H19F2NOS2 — CID 46576054
3-(3,4-difluorophenyl)-N-[3-(1,3-dithian-2-yl)phenyl]propanamide (PubChem CID 46576054) has the molecular formula C19H19F2NOS2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[3-(1,3-dithian-2-yl)phenyl]propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[3-(1,3-dithian-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 46576054 |
| Molecular Formula | C19H19F2NOS2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[3-(1,3-dithian-2-yl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(F)c(F)c1)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C19H19F2NOS2/c20-16-7-5-13(11-17(16)21)6-8-18(23)22-15-4-1-3-14(12-15)19-24-9-2-10-25-19/h1,3-5,7,11-12,19H,2,6,8-10H2,(H,22,23) |
| InChIKey | NSWDVLNADPRIAE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |