C16H21NOS2 — CID 78811101
2-cyclopentyl-N-[3-(1,3-dithiolan-2-yl)phenyl]acetamide (PubChem CID 78811101) has the molecular formula C16H21NOS2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-(1,3-dithiolan-2-yl)phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[3-(1,3-dithiolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 78811101 |
| Molecular Formula | C16H21NOS2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-cyclopentyl-N-[3-(1,3-dithiolan-2-yl)phenyl]acetamide |
| SMILES | O=C(CC1CCCC1)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C16H21NOS2/c18-15(10-12-4-1-2-5-12)17-14-7-3-6-13(11-14)16-19-8-9-20-16/h3,6-7,11-12,16H,1-2,4-5,8-10H2,(H,17,18) |
| InChIKey | UTBORWFAARKDQE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |