C18H20N2O3S2 — CID 27842854
N-[3-[3-(1,3-dithian-2-yl)anilino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 27842854) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[3-[3-(1,3-dithian-2-yl)anilino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[3-(1,3-dithian-2-yl)anilino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27842854 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[3-[3-(1,3-dithian-2-yl)anilino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C18H20N2O3S2/c21-16(7-8-19-17(22)15-6-2-9-23-15)20-14-5-1-4-13(12-14)18-24-10-3-11-25-18/h1-2,4-6,9,12,18H,3,7-8,10-11H2,(H,19,22)(H,20,21) |
| InChIKey | CIIAINKXLGFJQH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |