C19H24N2O3S2 — CID 55699175
1-[3-(1,3-dithian-2-yl)phenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea (PubChem CID 55699175) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-[3-(1,3-dithian-2-yl)phenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-[3-(1,3-dithian-2-yl)phenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 55699175 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-[3-(1,3-dithian-2-yl)phenyl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
| SMILES | O=C(NCCCOCc1ccco1)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C19H24N2O3S2/c22-19(20-8-3-9-23-14-17-7-2-10-24-17)21-16-6-1-5-15(13-16)18-25-11-4-12-26-18/h1-2,5-7,10,13,18H,3-4,8-9,11-12,14H2,(H2,20,21,22) |
| InChIKey | TZIDYESHHOBCLV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|