C13H20N2O3S — CID 82909429
N-[3-(furan-2-ylmethoxy)propyl]thiomorpholine-3-carboxamide (PubChem CID 82909429) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82909429 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]thiomorpholine-3-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)C1CSCCN1 |
| InChI | InChI=1S/C13H20N2O3S/c16-13(12-10-19-8-5-14-12)15-4-2-6-17-9-11-3-1-7-18-11/h1,3,7,12,14H,2,4-6,8-10H2,(H,15,16) |
| InChIKey | XLFYAQWDXMSMRA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|