C15H16ClN3O5 — CID 51115154
1-(4-chloro-3-nitrophenyl)-3-[3-(furan-2-ylmethoxy)propyl]urea (PubChem CID 51115154) has the molecular formula C15H16ClN3O5 and a molecular weight of 353.76 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-3-[3-(furan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-3-[3-(furan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 51115154 |
| Molecular Formula | C15H16ClN3O5 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-3-[3-(furan-2-ylmethoxy)propyl]urea |
| SMILES | O=C(NCCCOCc1ccco1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16ClN3O5/c16-13-5-4-11(9-14(13)19(21)22)18-15(20)17-6-2-7-23-10-12-3-1-8-24-12/h1,3-5,8-9H,2,6-7,10H2,(H2,17,18,20) |
| InChIKey | SFHHAHRSDRFNAP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|