C14H20N2OS3 — CID 71901881
1-[3-(1,3-dithian-2-yl)phenyl]-3-(2-methoxyethyl)thiourea (PubChem CID 71901881) has the molecular formula C14H20N2OS3 and a molecular weight of 328.53 g/mol. Its IUPAC name is 1-[3-(1,3-dithian-2-yl)phenyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[3-(1,3-dithian-2-yl)phenyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 71901881 |
| Molecular Formula | C14H20N2OS3 |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-[3-(1,3-dithian-2-yl)phenyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C14H20N2OS3/c1-17-7-6-15-14(18)16-12-5-2-4-11(10-12)13-19-8-3-9-20-13/h2,4-5,10,13H,3,6-9H2,1H3,(H2,15,16,18) |
| InChIKey | GLCFTIHXMFGXHT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|