C22H29N3O3S — CID 54787770
N-[[3-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 54787770) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[[3-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[3-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54787770 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[[3-(2-methoxyethylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | COCCNC(=O)c1cccc(NC(=S)NC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H29N3O3S/c1-28-6-5-23-19(26)17-3-2-4-18(10-17)24-21(29)25-20(27)22-11-14-7-15(12-22)9-16(8-14)13-22/h2-4,10,14-16H,5-9,11-13H2,1H3,(H,23,26)(H2,24,25,27,29) |
| InChIKey | RDNMTJOPAOEGGI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|