C17H21N3OS2 — CID 38797742
2-(3,5-dimethylpyrazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide (PubChem CID 38797742) has the molecular formula C17H21N3OS2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 38797742 |
| Molecular Formula | C17H21N3OS2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide |
| SMILES | Cc1cc(C)n(CC(=O)Nc2cccc(C3SCCCS3)c2)n1 |
| InChI | InChI=1S/C17H21N3OS2/c1-12-9-13(2)20(19-12)11-16(21)18-15-6-3-5-14(10-15)17-22-7-4-8-23-17/h3,5-6,9-10,17H,4,7-8,11H2,1-2H3,(H,18,21) |
| InChIKey | OYKXOJBASZRPOM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |