C18H18N4OS2 — CID 46820366
2-(benzotriazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide (PubChem CID 46820366) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 46820366 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[3-(1,3-dithian-2-yl)phenyl]acetamide |
| SMILES | O=C(Cn1nnc2ccccc21)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C18H18N4OS2/c23-17(12-22-16-8-2-1-7-15(16)20-21-22)19-14-6-3-5-13(11-14)18-24-9-4-10-25-18/h1-3,5-8,11,18H,4,9-10,12H2,(H,19,23) |
| InChIKey | MMGABFBGYMCCID-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |