C17H17NOS2 — CID 27889252
N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylbenzamide (PubChem CID 27889252) has the molecular formula C17H17NOS2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylbenzamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 27889252 |
| Molecular Formula | C17H17NOS2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C17H17NOS2/c1-12-5-2-3-8-15(12)16(19)18-14-7-4-6-13(11-14)17-20-9-10-21-17/h2-8,11,17H,9-10H2,1H3,(H,18,19) |
| InChIKey | PUKLAGYPYBWISW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |