C19H16N2OS2 — CID 26032711
N-[3-(1,3-dithiolan-2-yl)phenyl]quinoline-5-carboxamide (PubChem CID 26032711) has the molecular formula C19H16N2OS2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]quinoline-5-carboxamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 26032711 |
| Molecular Formula | C19H16N2OS2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]quinoline-5-carboxamide |
| SMILES | O=C(Nc1cccc(C2SCCS2)c1)c1cccc2ncccc12 |
| InChI | InChI=1S/C19H16N2OS2/c22-18(16-6-2-8-17-15(16)7-3-9-20-17)21-14-5-1-4-13(12-14)19-23-10-11-24-19/h1-9,12,19H,10-11H2,(H,21,22) |
| InChIKey | VNTAJHIHUSTCSK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |