C20H19N3OS2 — CID 34441538
N-[3-(1,3-dithiolan-2-yl)phenyl]-5-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 34441538) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-5-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 34441538 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(C3SCCS3)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C20H19N3OS2/c1-14-18(13-21-23(14)17-8-3-2-4-9-17)19(24)22-16-7-5-6-15(12-16)20-25-10-11-26-20/h2-9,12-13,20H,10-11H2,1H3,(H,22,24) |
| InChIKey | JAMKLPFFETVJGO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |