C19H17N7O — CID 41360742
5-methyl-N-[3-(1-methyltetrazol-5-yl)phenyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 41360742) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 5-methyl-N-[3-(1-methyltetrazol-5-yl)phenyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[3-(1-methyltetrazol-5-yl)phenyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 41360742 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-methyl-N-[3-(1-methyltetrazol-5-yl)phenyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(-c3nnnn3C)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C19H17N7O/c1-13-17(12-20-26(13)16-9-4-3-5-10-16)19(27)21-15-8-6-7-14(11-15)18-22-23-24-25(18)2/h3-12H,1-2H3,(H,21,27) |
| InChIKey | XDLSUFVBYPVKBQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |