C22H23N3O2S2 — CID 56512888
N'-(2-cyanoethyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-N'-phenylbutanediamide (PubChem CID 56512888) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56512888 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[3-(1,3-dithiolan-2-yl)phenyl]-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)Nc1cccc(C2SCCS2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2S2/c23-12-5-13-25(19-8-2-1-3-9-19)21(27)11-10-20(26)24-18-7-4-6-17(16-18)22-28-14-15-29-22/h1-4,6-9,16,22H,5,10-11,13-15H2,(H,24,26) |
| InChIKey | DQQULJYJPGABGI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |