C26H26N4O4S — CID 56505302
N-[3-(benzenesulfonamido)-4-methylphenyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide (PubChem CID 56505302) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-methylphenyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56505302 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)N(CCC#N)c2ccccc2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-20-13-14-21(19-24(20)29-35(33,34)23-11-6-3-7-12-23)28-25(31)15-16-26(32)30(18-8-17-27)22-9-4-2-5-10-22/h2-7,9-14,19,29H,8,15-16,18H2,1H3,(H,28,31) |
| InChIKey | LVXDNVPNKYACLH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |