C24H26N4O3 — CID 56505725
N'-(2-cyanoethyl)-N-[1-(2-methoxyethyl)indol-5-yl]-N'-phenylbutanediamide (PubChem CID 56505725) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[1-(2-methoxyethyl)indol-5-yl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[1-(2-methoxyethyl)indol-5-yl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56505725 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[1-(2-methoxyethyl)indol-5-yl]-N'-phenylbutanediamide |
| SMILES | COCCn1ccc2cc(NC(=O)CCC(=O)N(CCC#N)c3ccccc3)ccc21 |
| InChI | InChI=1S/C24H26N4O3/c1-31-17-16-27-15-12-19-18-20(8-9-22(19)27)26-23(29)10-11-24(30)28(14-5-13-25)21-6-3-2-4-7-21/h2-4,6-9,12,15,18H,5,10-11,14,16-17H2,1H3,(H,26,29) |
| InChIKey | PCDCJNNFNPTIQG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |