C18H23N3O2 — CID 56540825
N'-(2-cyanoethyl)-N-(1-cyclopropylethyl)-N'-phenylbutanediamide (PubChem CID 56540825) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-(1-cyclopropylethyl)-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-(1-cyclopropylethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56540825 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N'-(2-cyanoethyl)-N-(1-cyclopropylethyl)-N'-phenylbutanediamide |
| SMILES | CC(NC(=O)CCC(=O)N(CCC#N)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H23N3O2/c1-14(15-8-9-15)20-17(22)10-11-18(23)21(13-5-12-19)16-6-3-2-4-7-16/h2-4,6-7,14-15H,5,8-11,13H2,1H3,(H,20,22) |
| InChIKey | JOWNZOXQFSQKRT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |