C24H34N4O3 — CID 56577805
N'-(2-cyanoethyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-N'-phenylbutanediamide (PubChem CID 56577805) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56577805 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]-N'-phenylbutanediamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)CCC(=O)N(CCC#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N4O3/c1-3-19(4-2)24(31)27-17-13-20(14-18-27)26-22(29)11-12-23(30)28(16-8-15-25)21-9-6-5-7-10-21/h5-7,9-10,19-20H,3-4,8,11-14,16-18H2,1-2H3,(H,26,29) |
| InChIKey | NGPFBCTYIQHHJA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |