C26H32N4O2 — CID 56505702
N'-(2-cyanoethyl)-N-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-N'-phenylbutanediamide (PubChem CID 56505702) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-N'-phenylbutanediamide.
| Compound Name | N'-(2-cyanoethyl)-N-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56505702 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N'-(2-cyanoethyl)-N-[1-[(2-methylphenyl)methyl]piperidin-4-yl]-N'-phenylbutanediamide |
| SMILES | Cc1ccccc1CN1CCC(NC(=O)CCC(=O)N(CCC#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O2/c1-21-8-5-6-9-22(21)20-29-18-14-23(15-19-29)28-25(31)12-13-26(32)30(17-7-16-27)24-10-3-2-4-11-24/h2-6,8-11,23H,7,12-15,17-20H2,1H3,(H,28,31) |
| InChIKey | VEVHCKGTPQGUDL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |