C23H32N4O4 — CID 56513571
tert-butyl N-[1-[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]piperidin-4-yl]carbamate (PubChem CID 56513571) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 56513571 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | tert-butyl N-[1-[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)CCC(=O)N(CCC#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N4O4/c1-23(2,3)31-22(30)25-18-12-16-26(17-13-18)20(28)10-11-21(29)27(15-7-14-24)19-8-5-4-6-9-19/h4-6,8-9,18H,7,10-13,15-17H2,1-3H3,(H,25,30) |
| InChIKey | ZMFODLMKDXKLNS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |