C25H29ClN4O2 — CID 56515823
N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide (PubChem CID 56515823) has the molecular formula C25H29ClN4O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56515823 |
| Molecular Formula | C25H29ClN4O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NC1CCN(Cc2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H29ClN4O2/c26-21-9-7-20(8-10-21)19-29-17-13-22(14-18-29)28-24(31)11-12-25(32)30(16-4-15-27)23-5-2-1-3-6-23/h1-3,5-10,22H,4,11-14,16-19H2,(H,28,31) |
| InChIKey | ZHLPNBYETUQDCD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |