C18H17ClN2OS — CID 2361833
2-[(4-chlorophenyl)methylsulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide (PubChem CID 2361833) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 2361833 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-(2-cyanoethyl)-N-phenylacetamide |
| SMILES | N#CCCN(C(=O)CSCc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H17ClN2OS/c19-16-9-7-15(8-10-16)13-23-14-18(22)21(12-4-11-20)17-5-2-1-3-6-17/h1-3,5-10H,4,12-14H2 |
| InChIKey | YPZVMBHHUBMQNG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |