C23H24ClN3O4 — CID 56515615
methyl 3-(2-chlorophenyl)-3-[[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]amino]propanoate (PubChem CID 56515615) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 56515615 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[[4-[N-(2-cyanoethyl)anilino]-4-oxobutanoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CCC(=O)N(CCC#N)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C23H24ClN3O4/c1-31-23(30)16-20(18-10-5-6-11-19(18)24)26-21(28)12-13-22(29)27(15-7-14-25)17-8-3-2-4-9-17/h2-6,8-11,20H,7,12-13,15-16H2,1H3,(H,26,28) |
| InChIKey | IIFDUZPQHHOAIK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |