C24H22ClN3O2S — CID 56506370
N-[(4-chlorophenyl)-thiophen-3-ylmethyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide (PubChem CID 56506370) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-thiophen-3-ylmethyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide.
| Compound Name | N-[(4-chlorophenyl)-thiophen-3-ylmethyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
|---|---|
| PubChem CID | 56506370 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N-[(4-chlorophenyl)-thiophen-3-ylmethyl]-N'-(2-cyanoethyl)-N'-phenylbutanediamide |
| SMILES | N#CCCN(C(=O)CCC(=O)NC(c1ccc(Cl)cc1)c1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C24H22ClN3O2S/c25-20-9-7-18(8-10-20)24(19-13-16-31-17-19)27-22(29)11-12-23(30)28(15-4-14-26)21-5-2-1-3-6-21/h1-3,5-10,13,16-17,24H,4,11-12,15H2,(H,27,29) |
| InChIKey | SNNDXOVAJLRAMK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |