C24H25N5O2 — CID 56504550
N'-(2-cyanoethyl)-N'-phenyl-N-[1-(5-phenyl-1H-imidazol-2-yl)ethyl]butanediamide (PubChem CID 56504550) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N'-phenyl-N-[1-(5-phenyl-1H-imidazol-2-yl)ethyl]butanediamide.
| Compound Name | N'-(2-cyanoethyl)-N'-phenyl-N-[1-(5-phenyl-1H-imidazol-2-yl)ethyl]butanediamide |
|---|---|
| PubChem CID | 56504550 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N'-(2-cyanoethyl)-N'-phenyl-N-[1-(5-phenyl-1H-imidazol-2-yl)ethyl]butanediamide |
| SMILES | CC(NC(=O)CCC(=O)N(CCC#N)c1ccccc1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H25N5O2/c1-18(24-26-17-21(28-24)19-9-4-2-5-10-19)27-22(30)13-14-23(31)29(16-8-15-25)20-11-6-3-7-12-20/h2-7,9-12,17-18H,8,13-14,16H2,1H3,(H,26,28)(H,27,30) |
| InChIKey | IAWSPEQZADQVES-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |