C16H17ClN2O2S — CID 86840905
2-acetamido-N-[(4-chlorophenyl)-thiophen-3-ylmethyl]propanamide (PubChem CID 86840905) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 2-acetamido-N-[(4-chlorophenyl)-thiophen-3-ylmethyl]propanamide.
| Compound Name | 2-acetamido-N-[(4-chlorophenyl)-thiophen-3-ylmethyl]propanamide |
|---|---|
| PubChem CID | 86840905 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-acetamido-N-[(4-chlorophenyl)-thiophen-3-ylmethyl]propanamide |
| SMILES | CC(=O)NC(C)C(=O)NC(c1ccc(Cl)cc1)c1ccsc1 |
| InChI | InChI=1S/C16H17ClN2O2S/c1-10(18-11(2)20)16(21)19-15(13-7-8-22-9-13)12-3-5-14(17)6-4-12/h3-10,15H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | NNLGKOCLAGWYIB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |