C17H21ClN2O3 — CID 95769163
methyl (3S)-3-[[2-[but-3-ynyl(methyl)amino]acetyl]amino]-3-(2-chlorophenyl)propanoate (PubChem CID 95769163) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is methyl (3S)-3-[[2-[but-3-ynyl(methyl)amino]acetyl]amino]-3-(2-chlorophenyl)propanoate.
| Compound Name | methyl (3S)-3-[[2-[but-3-ynyl(methyl)amino]acetyl]amino]-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 95769163 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | methyl (3S)-3-[[2-[but-3-ynyl(methyl)amino]acetyl]amino]-3-(2-chlorophenyl)propanoate |
| SMILES | C#CCCN(C)CC(=O)N[C@@H](CC(=O)OC)c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN2O3/c1-4-5-10-20(2)12-16(21)19-15(11-17(22)23-3)13-8-6-7-9-14(13)18/h1,6-9,15H,5,10-12H2,2-3H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | HFBWDGFDCILYPN-HNNXBMFYSA-N |
| XLogP | 2.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|