C17H20ClNO3 — CID 38591349
methyl (3S)-3-(2-chlorophenyl)-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]propanoate (PubChem CID 38591349) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is methyl (3S)-3-(2-chlorophenyl)-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]propanoate.
| Compound Name | methyl (3S)-3-(2-chlorophenyl)-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 38591349 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | methyl (3S)-3-(2-chlorophenyl)-3-[[2-[(1R)-cyclopent-2-en-1-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)C[C@@H]1C=CCC1)c1ccccc1Cl |
| InChI | InChI=1S/C17H20ClNO3/c1-22-17(21)11-15(13-8-4-5-9-14(13)18)19-16(20)10-12-6-2-3-7-12/h2,4-6,8-9,12,15H,3,7,10-11H2,1H3,(H,19,20)/t12-,15+/m1/s1 |
| InChIKey | UCVKCKNZKUCYJG-DOMZBBRYSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|