C21H23NO — CID 34189438
2-[(1S)-cyclopent-2-en-1-yl]-N-[(1R)-1,2-diphenylethyl]acetamide (PubChem CID 34189438) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1R)-1,2-diphenylethyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1R)-1,2-diphenylethyl]acetamide |
|---|---|
| PubChem CID | 34189438 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1R)-1,2-diphenylethyl]acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)N[C@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO/c23-21(16-18-11-7-8-12-18)22-20(19-13-5-2-6-14-19)15-17-9-3-1-4-10-17/h1-7,9-11,13-14,18,20H,8,12,15-16H2,(H,22,23)/t18-,20+/m0/s1 |
| InChIKey | IOCNLHFTIWBOHS-AZUAARDMSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|