C19H21F2N3O — CID 95141872
2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-[1-(difluoromethyl)imidazol-2-yl]-1-phenylethyl]acetamide (PubChem CID 95141872) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-[1-(difluoromethyl)imidazol-2-yl]-1-phenylethyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-[1-(difluoromethyl)imidazol-2-yl]-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 95141872 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[(1S)-2-[1-(difluoromethyl)imidazol-2-yl]-1-phenylethyl]acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)N[C@@H](Cc1nccn1C(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H21F2N3O/c20-19(21)24-11-10-22-17(24)13-16(15-8-2-1-3-9-15)23-18(25)12-14-6-4-5-7-14/h1-4,6,8-11,14,16,19H,5,7,12-13H2,(H,23,25)/t14-,16-/m0/s1 |
| InChIKey | FZDKQGGTURVRMO-HOCLYGCPSA-N |
| XLogP | 4.03 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|