C19H25NO — CID 75746940
2-cyclopent-2-en-1-yl-N-(4-phenylcyclohexyl)acetamide (PubChem CID 75746940) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(4-phenylcyclohexyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(4-phenylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 75746940 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(4-phenylcyclohexyl)acetamide |
| SMILES | O=C(CC1C=CCC1)NC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25NO/c21-19(14-15-6-4-5-7-15)20-18-12-10-17(11-13-18)16-8-2-1-3-9-16/h1-4,6,8-9,15,17-18H,5,7,10-14H2,(H,20,21) |
| InChIKey | HVOFHNUAWYZYRV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|