C13H16N2O — CID 51714392
N-(2-aminophenyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide (PubChem CID 51714392) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-(2-aminophenyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 51714392 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(2-aminophenyl)-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
| SMILES | Nc1ccccc1NC(=O)C[C@H]1C=CCC1 |
| InChI | InChI=1S/C13H16N2O/c14-11-7-3-4-8-12(11)15-13(16)9-10-5-1-2-6-10/h1,3-5,7-8,10H,2,6,9,14H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | IQVUGXWFXKDEOI-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|