C13H13F2NO — CID 94813097
2-[(1S)-cyclopent-2-en-1-yl]-N-(2,3-difluorophenyl)acetamide (PubChem CID 94813097) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-(2,3-difluorophenyl)acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-(2,3-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 94813097 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-(2,3-difluorophenyl)acetamide |
| SMILES | O=C(C[C@H]1C=CCC1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C13H13F2NO/c14-10-6-3-7-11(13(10)15)16-12(17)8-9-4-1-2-5-9/h1,3-4,6-7,9H,2,5,8H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | HOTYTPNYGYPIHP-VIFPVBQESA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|