C14H15F2NOS — CID 78807815
2-cyclopent-2-en-1-yl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 78807815) has the molecular formula C14H15F2NOS and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78807815 |
| Molecular Formula | C14H15F2NOS |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CC1C=CCC1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C14H15F2NOS/c15-14(16)19-12-8-4-3-7-11(12)17-13(18)9-10-5-1-2-6-10/h1,3-5,7-8,10,14H,2,6,9H2,(H,17,18) |
| InChIKey | BPCLABWETVQIQB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|