C9H8BrF2NOS — CID 63678703
2-bromo-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 63678703) has the molecular formula C9H8BrF2NOS and a molecular weight of 296.14 g/mol. Its IUPAC name is 2-bromo-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-bromo-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 63678703 |
| Molecular Formula | C9H8BrF2NOS |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | 2-bromo-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CBr)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C9H8BrF2NOS/c10-5-8(14)13-6-3-1-2-4-7(6)15-9(11)12/h1-4,9H,5H2,(H,13,14) |
| InChIKey | AAUFSMRGFOLHMJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|