C15H12F3NOS2 — CID 42000152
N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-fluorophenyl)sulfanylacetamide (PubChem CID 42000152) has the molecular formula C15H12F3NOS2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 42000152 |
| Molecular Formula | C15H12F3NOS2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-fluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(F)cc1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C15H12F3NOS2/c16-10-5-7-11(8-6-10)21-9-14(20)19-12-3-1-2-4-13(12)22-15(17)18/h1-8,15H,9H2,(H,19,20) |
| InChIKey | KWHNNUXIGALJRZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |