C17H17F2NO2S — CID 112766444
N-[2-(difluoromethylsulfanyl)phenyl]-4-phenoxybutanamide (PubChem CID 112766444) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-4-phenoxybutanamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 112766444 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C17H17F2NO2S/c18-17(19)23-15-10-5-4-9-14(15)20-16(21)11-6-12-22-13-7-2-1-3-8-13/h1-5,7-10,17H,6,11-12H2,(H,20,21) |
| InChIKey | CICNKMJFLKKWRZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|