C14H17F2NO2S — CID 111432184
N-[2-(difluoromethylsulfanyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111432184) has the molecular formula C14H17F2NO2S and a molecular weight of 301.36 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111432184 |
| Molecular Formula | C14H17F2NO2S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | O=C(CC1(O)CCCC1)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C14H17F2NO2S/c15-13(16)20-11-6-2-1-5-10(11)17-12(18)9-14(19)7-3-4-8-14/h1-2,5-6,13,19H,3-4,7-9H2,(H,17,18) |
| InChIKey | NBTGPUZQVRJFMU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |