C15H18F2N4O — CID 86998907
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(1-phenylethyl)urea (PubChem CID 86998907) has the molecular formula C15H18F2N4O and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(1-phenylethyl)urea.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 86998907 |
| Molecular Formula | C15H18F2N4O |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)N(C)Cc1nccn1C(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H18F2N4O/c1-11(12-6-4-3-5-7-12)19-15(22)20(2)10-13-18-8-9-21(13)14(16)17/h3-9,11,14H,10H2,1-2H3,(H,19,22) |
| InChIKey | WFXABZBDEQGBIL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |