C22H23F2N5OS — CID 78891238
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(3-phenothiazin-10-ylpropyl)urea (PubChem CID 78891238) has the molecular formula C22H23F2N5OS and a molecular weight of 443.52 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(3-phenothiazin-10-ylpropyl)urea.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(3-phenothiazin-10-ylpropyl)urea |
|---|---|
| PubChem CID | 78891238 |
| Molecular Formula | C22H23F2N5OS |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-(3-phenothiazin-10-ylpropyl)urea |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)NCCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H23F2N5OS/c1-27(15-20-25-12-14-29(20)21(23)24)22(30)26-11-6-13-28-16-7-2-4-9-18(16)31-19-10-5-3-8-17(19)28/h2-5,7-10,12,14,21H,6,11,13,15H2,1H3,(H,26,30) |
| InChIKey | JPSIUIMLXVAGNJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|