C15H24F2N4O3 — CID 78887315
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]urea (PubChem CID 78887315) has the molecular formula C15H24F2N4O3 and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 78887315 |
| Molecular Formula | C15H24F2N4O3 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]urea |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C15H24F2N4O3/c1-20(10-13-18-6-7-21(13)14(16)17)15(22)19-5-3-8-23-11-12-4-2-9-24-12/h6-7,12,14H,2-5,8-11H2,1H3,(H,19,22) |
| InChIKey | JIJHSGYFWATVLG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|