C11H17F2N5O — CID 119120768
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine (PubChem CID 119120768) has the molecular formula C11H17F2N5O and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119120768 |
| Molecular Formula | C11H17F2N5O |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1nccn1C(F)F)NCC1CCCO1 |
| InChI | InChI=1S/C11H17F2N5O/c12-10(13)18-4-3-15-9(18)7-17-11(14)16-6-8-2-1-5-19-8/h3-4,8,10H,1-2,5-7H2,(H3,14,16,17) |
| InChIKey | AQXZYGRIZYDCMZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|