C12H14F2IN5 — CID 110918564
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-phenylguanidine;hydroiodide (PubChem CID 110918564) has the molecular formula C12H14F2IN5 and a molecular weight of 393.18 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110918564 |
| Molecular Formula | C12H14F2IN5 |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nccn1C(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C12H13F2N5.HI/c13-11(14)19-7-6-16-10(19)8-17-12(15)18-9-4-2-1-3-5-9;/h1-7,11H,8H2,(H3,15,17,18);1H |
| InChIKey | DESCIJIPLNPVFE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|