C10H18F2IN5 — CID 110921032
1-butan-2-yl-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 110921032) has the molecular formula C10H18F2IN5 and a molecular weight of 373.19 g/mol. Its IUPAC name is 1-butan-2-yl-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110921032 |
| Molecular Formula | C10H18F2IN5 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 1-butan-2-yl-2-[[1-(difluoromethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/Cc1nccn1C(F)F.I |
| InChI | InChI=1S/C10H17F2N5.HI/c1-3-7(2)16-10(13)15-6-8-14-4-5-17(8)9(11)12;/h4-5,7,9H,3,6H2,1-2H3,(H3,13,15,16);1H |
| InChIKey | ORNWVVSTZHPRFV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|