C13H22F2N6 — CID 111088587
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111088587) has the molecular formula C13H22F2N6 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111088587 |
| Molecular Formula | C13H22F2N6 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(N)=N/Cc1nccn1C(F)F |
| InChI | InChI=1S/C13H22F2N6/c1-2-20-6-3-4-10(20)8-18-13(16)19-9-11-17-5-7-21(11)12(14)15/h5,7,10,12H,2-4,6,8-9H2,1H3,(H3,16,18,19) |
| InChIKey | SQEFTSZPQUIKDX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|