C15H27F2IN6O — CID 111021166
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111021166) has the molecular formula C15H27F2IN6O and a molecular weight of 472.32 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111021166 |
| Molecular Formula | C15H27F2IN6O |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCC(C)N1CCOCC1.I |
| InChI | InChI=1S/C15H26F2N6O.HI/c1-3-18-15(20-10-12(2)22-6-8-24-9-7-22)21-11-13-19-4-5-23(13)14(16)17;/h4-5,12,14H,3,6-11H2,1-2H3,(H2,18,20,21);1H |
| InChIKey | TWKYDVHFVYMTNU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|